Phenol,4,4'-(1,2-diazenediyl)bis structure
|
Common Name | Phenol,4,4'-(1,2-diazenediyl)bis | ||
|---|---|---|---|---|
| CAS Number | 2050-16-0 | Molecular Weight | 214.22000 | |
| Density | 1.24g/cm3 | Boiling Point | 392ºC at 760mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | 215 °C(dec.) | |
| MSDS | N/A | Flash Point | 190.9ºC | |
| Name | 4-[(4-hydroxyphenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 392ºC at 760mmHg |
| Melting Point | 215 °C(dec.) |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 190.9ºC |
| Exact Mass | 214.07400 |
| PSA | 65.18000 |
| LogP | 3.51320 |
| Vapour Pressure | 1.04E-06mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | WKODVHZBYIBMOC-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Nc2ccc(O)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2927000090 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: The compound was tested for antiviral activity against Herpes simplex virus type-1 in...
Source: ChEMBL
Target: Vero
External Id: CHEMBL815923
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Induction of human ApoA-1 gene expression in human Caco-2 cells co-transfected with l...
Source: ChEMBL
Target: Caco-2
External Id: CHEMBL1112013
|
|
Name: Induction of human ApoA-1 gene expression in human Caco-2 cells co-transfected with l...
Source: ChEMBL
Target: Caco-2
External Id: CHEMBL1112012
|
|
Name: Binding affinity to ERalpha (unknown origin) relative to estradiol
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL3243180
|
| 4'-Hydroxyazobenzene-4-ol |
| 4,4'-azobis(phenol) |
| 4,4-(diazene-1,2-diyl)diphenol |
| Phenol,4,4'-azobis |
| 4,4'-bis-hydroxyazobenzene |
| 4,4`-(1,2-Diazenediyl)bisphenol |
| 4-(4-hydroxy-phenylazo)phenol |
| 4,4'-Azodiphenol |
| Azobenzene-4,4'-diol |