SAHM1 TFA structure
|
Common Name | SAHM1 TFA | ||
|---|---|---|---|---|
| CAS Number | 2050906-89-1 | Molecular Weight | 2196.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C94H162N36O23S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SAHM1 TFASAHM1 is a Notch pathway inhibitor. SAHM1 stabilizes hydrocarbon-stapled alpha helical peptide. SAHM1 targets the protein-protein interface and prevents Notch complex assembly. |
| Name | SAHM1 |
|---|
| Description | SAHM1 is a Notch pathway inhibitor. SAHM1 stabilizes hydrocarbon-stapled alpha helical peptide. SAHM1 targets the protein-protein interface and prevents Notch complex assembly. |
|---|---|
| Related Catalog |
| Molecular Formula | C94H162N36O23S |
|---|---|
| Molecular Weight | 2196.58 |
| InChIKey | ADWKVIAAKDSBNE-VHQDTIAVSA-N |
| SMILES | CCC(C)C(NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(C)=O)C(=O)NC1(C)CCCC=CCCCC(C)(C(=O)NC(Cc2c[nH]cn2)C(=O)NC(Cc2c[nH]cn2)C(=O)NC(CO)C(=O)NC(C(=O)O)C(C)O)NC(=O)C(CCCNC(=N)N)NC(=O)C(CS)NC(=O)C(CC(C)C)NC1=O |