(Tributylstannyl)-pyrazine structure
|
Common Name | (Tributylstannyl)-pyrazine | ||
|---|---|---|---|---|
| CAS Number | 205371-27-3 | Molecular Weight | 369.133 | |
| Density | 1.1706 g/mL at 25 °C | Boiling Point | 380.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H30N2Sn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 183.6±28.7 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | tributyl(pyrazin-2-yl)stannane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1706 g/mL at 25 °C |
|---|---|
| Boiling Point | 380.1±45.0 °C at 760 mmHg |
| Molecular Formula | C16H30N2Sn |
| Molecular Weight | 369.133 |
| Flash Point | 183.6±28.7 °C |
| Exact Mass | 370.143097 |
| PSA | 25.78000 |
| LogP | 7.52 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | n20/D 1.5158 |
| InChIKey | OVBXTKIWZAHFAC-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnccn1 |
| Storage condition | Keep Cold |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39-61-60-45-35 |
| RIDADR | UN 2788 6.1/PG 2 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Tetrahedron Lett. 48 , 2063, (2007)
|
| 2-(Tri-n-butylstannyl)pyrazine |
| Tributylstannylpyrazine |
| Pyrazine, 2-(tributylstannyl)- |
| (Tributylstannyl)-pyrazine |
| 2-(Tributylstannyl)pyrazine |