MC-Val-Cit-PAB-vinblastine
Modify Date: 2025-08-27 19:01:52
MC-Val-Cit-PAB-vinblastine structure
|
Common Name | MC-Val-Cit-PAB-vinblastine | ||
|---|---|---|---|---|
| CAS Number | 2055896-92-7 | Molecular Weight | 1366.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C74H97N10O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-Val-Cit-PAB-vinblastineMC-Val-Cit-PAB-vinblastine has a bioreversible linkage based on a quaternary ammonium for targeted delivery and it can improve pharmacokinetics and the therapeutic index. MC-Val-Cit-PAB-vinblastine is used for the antibody-drug conjugates (ADC) that are effective and stable in vitro and in vivo to treat various diseases or disorders[1]. |
| Name | MC-Val-Cit-PAB-vinblastine |
|---|
| Description | MC-Val-Cit-PAB-vinblastine has a bioreversible linkage based on a quaternary ammonium for targeted delivery and it can improve pharmacokinetics and the therapeutic index. MC-Val-Cit-PAB-vinblastine is used for the antibody-drug conjugates (ADC) that are effective and stable in vitro and in vivo to treat various diseases or disorders[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C74H97N10O15 |
|---|---|
| Molecular Weight | 1366.62 |
| InChIKey | UIGOTWKBGXIMLH-RWNFVDQVSA-O |
| SMILES | CCC1(O)CC2CC(C(=O)OC)(c3cc4c(cc3OC)N(C)C3C(O)(C(=O)OC)C(OC(C)=O)C5(CC)C=CCN6CCC43C65)c3[nH]c4ccccc4c3CC[N+](Cc3ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN4C(=O)C=CC4=O)C(C)C)cc3)(C2)C1 |