MC-Val-Cit-PAB-Auristatin E
Modify Date: 2025-09-17 00:48:11
MC-Val-Cit-PAB-Auristatin E structure
|
Common Name | MC-Val-Cit-PAB-Auristatin E | ||
|---|---|---|---|---|
| CAS Number | 2055896-77-8 | Molecular Weight | 1287.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C68H108N11O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-Val-Cit-PAB-Auristatin EMC-Val-Cit-PAB-Auristatin E has a bioreversible linkage based on a quaternary ammonium for targeted delivery and it can improve pharmacokinetics and the therapeutic index. MC-Val-Cit-PAB-Auristatin E is used for the antibody-drug conjugates (ADC) that are effective and stable in vitro and in vivo to treat various diseases or disorders[1]. |
| Name | MC-Val-Cit-PAB-Auristatin E |
|---|
| Description | MC-Val-Cit-PAB-Auristatin E has a bioreversible linkage based on a quaternary ammonium for targeted delivery and it can improve pharmacokinetics and the therapeutic index. MC-Val-Cit-PAB-Auristatin E is used for the antibody-drug conjugates (ADC) that are effective and stable in vitro and in vivo to treat various diseases or disorders[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C68H108N11O13 |
|---|---|
| Molecular Weight | 1287.65 |
| InChIKey | ULBSEZSVDXRNQN-UIMDRQLBSA-O |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(C)C(O)c1ccccc1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)[N+](C)(C)Cc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1)C(C)C |