Yohimbic acid hydrate structure
|
Common Name | Yohimbic acid hydrate | ||
|---|---|---|---|---|
| CAS Number | 207801-27-2 | Molecular Weight | 358.43100 | |
| Density | N/A | Boiling Point | 600ºC at 760 mmHg | |
| Molecular Formula | C20H26N2O4 | Melting Point | 267-268ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Yohimbic acid hydrateYohimbic acid hydrate is an amphoteric demethylated derivative of Yohimbine (HY-12715). Yohimbic acid hydrate exhibits vasodilatory action. Yohimbic acid hydrate also can be used for the research of osteoarthritis (OA)[1][2][3]. |
| Name | yohimbinic acid monohydrate 99 |
|---|---|
| Synonym | More Synonyms |
| Description | Yohimbic acid hydrate is an amphoteric demethylated derivative of Yohimbine (HY-12715). Yohimbic acid hydrate exhibits vasodilatory action. Yohimbic acid hydrate also can be used for the research of osteoarthritis (OA)[1][2][3]. |
|---|---|
| Related Catalog |
| Boiling Point | 600ºC at 760 mmHg |
|---|---|
| Melting Point | 267-268ºC (dec.)(lit.) |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.43100 |
| Exact Mass | 358.18900 |
| PSA | 85.79000 |
| LogP | 2.43230 |
| Vapour Pressure | 3.04E-15mmHg at 25°C |
| InChIKey | UXXCUDYYOMDFPX-GPRFVYSASA-N |
| SMILES | O.O=C(O)C1C(O)CCC2CN3CCc4c([nH]c5ccccc45)C3CC21 |
| Storage condition | 2-8°C |
| Hazard Codes | T+ |
|---|---|
| RIDADR | UN 1544 6.1/PG 3 |
| MFCD00167087 |