6-nitro-3,4-dihydro-1H-isochromene structure
|
Common Name | 6-nitro-3,4-dihydro-1H-isochromene | ||
|---|---|---|---|---|
| CAS Number | 207804-97-5 | Molecular Weight | 179.173 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 317.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.0±29.9 °C | |
| Name | 6-Nitro-3,4-dihydro-1H-isochromene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 317.1±42.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.173 |
| Flash Point | 158.0±29.9 °C |
| Exact Mass | 179.058243 |
| PSA | 55.05000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | RTBMEWOVRPAVMS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCOC2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-2-Benzopyran, 3,4-dihydro-6-nitro- |
| 3,4-dihydro-6-nitro-1H-2-benzopyran |
| 6-nitroisochroman |
| 6-Nitro-3,4-dihydro-1H-isochromene |