(2E)-3-(4-Chloro-3-nitrophenyl)acrylic acid structure
|
Common Name | (2E)-3-(4-Chloro-3-nitrophenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 20797-48-2 | Molecular Weight | 227.601 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 408.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H6ClNO4 | Melting Point | 188-190 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 200.9±25.9 °C | |
| Name | 4-Chloro-3-nitrocinnamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.6±35.0 °C at 760 mmHg |
| Melting Point | 188-190 °C(lit.) |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.601 |
| Flash Point | 200.9±25.9 °C |
| Exact Mass | 226.998535 |
| PSA | 83.12000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | QBDALTIMHOITIU-DUXPYHPUSA-N |
| SMILES | O=C(O)C=Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~%
(2E)-3-(4-Chlor... CAS#:20797-48-2 |
| Literature: Chemische Berichte, , vol. 103, p. 3850 - 3861 |
|
~%
(2E)-3-(4-Chlor... CAS#:20797-48-2 |
| Literature: Tetrahedron Letters, , p. 4979 - 4982 |
|
~%
(2E)-3-(4-Chlor... CAS#:20797-48-2 |
| Literature: Tetrahedron Letters, , p. 4979 - 4982 |
|
~%
(2E)-3-(4-Chlor... CAS#:20797-48-2 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 45, p. 694 Recueil des Travaux Chimiques des Pays-Bas, , vol. 48, p. 1137 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| trans-4-Chloro-3-nitrociamic acid |
| (2E)-3-(4-Chloro-3-nitrophenyl)acrylic acid |
| 4-Chloro-3-nitrocinnaMic Acid |
| 4-Chloro-3-nitrocinnamic Alcohol |
| trans-3-nitro-4-chlorocinnamic acid |
| 3-Nitro-4-chlorocinnamic acid |
| Trans-4-Chloro-3-Nitrocinnamic Acid |
| 4-chloro-3-nitrophenylcinnamic acid |
| MFCD00063311 |
| 3-(4-Chloro-3-nitrophenyl)acrylic acid |
| RARECHEM BK HW 0228 |