GPR35 agonist 1 structure
|
Common Name | GPR35 agonist 1 | ||
|---|---|---|---|---|
| CAS Number | 2079880-92-3 | Molecular Weight | 354.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4BrN5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GPR35 agonist 1GPR35 agonist 1 (compound 50) is a potent and specific G protein-coupled receptor-35 (GPR35) agonist with an EC50 of 5.8 nM, displays good druggability[1]. |
| Name | GPR35 agonist 1 |
|---|
| Description | GPR35 agonist 1 (compound 50) is a potent and specific G protein-coupled receptor-35 (GPR35) agonist with an EC50 of 5.8 nM, displays good druggability[1]. |
|---|---|
| Related Catalog | |
| Target |
EC50: 5.8 nM (GPR35)[1] |
| References |
| Molecular Formula | C10H4BrN5O5 |
|---|---|
| Molecular Weight | 354.07 |
| InChIKey | AQJFPDDDKBWBAG-UHFFFAOYSA-N |
| SMILES | O=c1oc2c([N+](=O)[O-])c(O)c(Br)cc2cc1-c1nn[nH]n1 |