SB-258585 structure
|
Common Name | SB-258585 | ||
|---|---|---|---|---|
| CAS Number | 209480-63-7 | Molecular Weight | 523.81600 | |
| Density | N/A | Boiling Point | 597.9ºC at 760 mmHg | |
| Molecular Formula | C18H23ClIN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.4ºC | |
Use of SB-258585SB-258585 is a potent, selective and orally active 5-HT6 receptor antagonist with Ki of 8.9 nM, >160-fold selectivity over other 5-HT receptor subtypes. |
| Name | 4-iodo-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzenesulfonamide,hydrochloride |
|---|
| Boiling Point | 597.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H23ClIN3O3S |
| Molecular Weight | 523.81600 |
| Flash Point | 315.4ºC |
| Exact Mass | 523.01900 |
| PSA | 70.26000 |
| LogP | 4.81110 |
| Vapour Pressure | 1.42E-14mmHg at 25°C |
| InChIKey | BDHMSYNBSBZCAF-UHFFFAOYSA-N |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(I)cc2)cc1N1CCN(C)CC1 |
| Hazard Codes | Xn |
|---|---|
| Safety Phrases | S26-S45-S36-S37 |