Milademetan tosylate hydrate structure
|
Common Name | Milademetan tosylate hydrate | ||
|---|---|---|---|---|
| CAS Number | 2095625-97-9 | Molecular Weight | 808.743 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H44Cl2FN5O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Milademetan tosylate hydrateMilademetan (DS-3032) tosylate hydrate is a specific and orally active MDM2 inhibitor for the research of acute myeloid leukemia (AML) or solid tumors. Milademetan (DS-3032) tosylate hydrate induces G1 cell cycle arrest, senescence and apoptosis. |
| Name | (3'R,4'S,5'R)-N-[(3R,6S)-6-Carbamoyltetrahydro-2H-pyran-3-yl]-6''-chloro-4'-(2-chloro-3-fluoro-4-pyridinyl)-4,4-dimethyl-2''-oxo-1'',2''-dihydrodispiro[cyclohexane-1,2'-pyrrolidine-3',3''-indole]-5'-carboxamide 4-methylbenzenesulfonate hydrate (1:1:1) (non-preferred name) |
|---|
| Molecular Formula | C37H44Cl2FN5O8S |
|---|---|
| Molecular Weight | 808.743 |
| Exact Mass | 807.227173 |
| InChIKey | WPJOGWGXMTUHPW-CIPNXXNHSA-N |
| SMILES | CC1(C)CCC2(CC1)NC(C(=O)NC1CCC(C(N)=O)OC1)C(c1ccnc(Cl)c1F)C21C(=O)Nc2cc(Cl)ccc21.Cc1ccc(S(=O)(=O)O)cc1.O |