para-amino-Blebbistatin structure
|
Common Name | para-amino-Blebbistatin | ||
|---|---|---|---|---|
| CAS Number | 2097734-03-5 | Molecular Weight | 307.346 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 571.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.3±32.9 °C | |
Use of para-amino-BlebbistatinPara-aminoblebbistatin is a highly water soluble, non-fluorescent and photostable C15 amino-substituted derivative of blebbistatin; inhibits various (myosin II) isoforms both in vitro and in vivo. |
| Name | para-amino-Blebbistatin |
|---|---|
| Synonym | More Synonyms |
| Description | Para-aminoblebbistatin is a highly water soluble, non-fluorescent and photostable C15 amino-substituted derivative of blebbistatin; inhibits various (myosin II) isoforms both in vitro and in vivo. |
|---|---|
| Related Catalog | |
| Target |
Myosin II[1] |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 571.3±60.0 °C at 760 mmHg |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.346 |
| Flash Point | 299.3±32.9 °C |
| Exact Mass | 307.132080 |
| LogP | 0.34 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | LYWLZINJPRNWFF-GOSISDBHSA-N |
| SMILES | Cc1ccc2c(c1)C(=O)C1(O)CCN(c3ccc(N)cc3)C1=N2 |
| Storage condition | 2-8°C |
| (3aS)-1-(4-Aminophenyl)-3a-hydroxy-6-methyl-1,2,3,3a-tetrahydro-4H-pyrrolo[2,3-b]quinolin-4-one |
| 4H-Pyrrolo[2,3-b]quinolin-4-one, 1-(4-aminophenyl)-1,2,3,3a-tetrahydro-3a-hydroxy-6-methyl-, (3aS)- |
| para-amino-Blebbistatin |