Betrixaban-d6 structure
|
Common Name | Betrixaban-d6 | ||
|---|---|---|---|---|
| CAS Number | 2098655-51-5 | Molecular Weight | 457.94 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H16D6ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Betrixaban-d6Betrixaban D6 is a deuterium labeled Betrixaban. Betrixaban is a highly potent, selective, and orally efficacious factor Xa (fXa) inhibitor[1]. |
| Name | Betrixaban D6 |
|---|
| Description | Betrixaban D6 is a deuterium labeled Betrixaban. Betrixaban is a highly potent, selective, and orally efficacious factor Xa (fXa) inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H16D6ClN5O3 |
|---|---|
| Molecular Weight | 457.94 |
| InChIKey | PGOYJYHMBCZDLN-YJKHHXLJSA-N |
| SMILES | COc1ccc(NC(=O)c2ccc(C=NN(C)C)cc2)c(C(=O)Nc2ccc(Cl)cn2)c1 |