N-PEG3-N'-(propargyl-PEG4)-Cy5 structure
|
Common Name | N-PEG3-N'-(propargyl-PEG4)-Cy5 | ||
|---|---|---|---|---|
| CAS Number | 2107273-06-1 | Molecular Weight | 737.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H57ClN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-PEG3-N'-(propargyl-PEG4)-Cy5N-PEG3-N'-(propargyl-PEG4)-Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | N-PEG3-N'-(propargyl-PEG4)-Cy5 |
|---|
| Description | N-PEG3-N'-(propargyl-PEG4)-Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C42H57ClN2O7 |
|---|---|
| Molecular Weight | 737.36 |
| InChIKey | MXPPWWDNHJQAKX-UHFFFAOYSA-M |
| SMILES | C#CCOCCOCCOCCOCCN1C(=CC=CC=CC2=[N+](CCOCCOCCO)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[Cl-] |
| Hazard Codes | Xi |
|---|