Dehydrosimvastatin structure
|
Common Name | Dehydrosimvastatin | ||
|---|---|---|---|---|
| CAS Number | 210980-68-0 | Molecular Weight | 400.551 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 536.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.6±28.5 °C | |
Use of DehydrosimvastatinAnhydrosimvastatin (Impurity C) is an impurity of Simvastatin. Simvastatin is a competitive inhibitor of HMG-CoA reductase[1]. |
| Name | [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R)-6-oxo-2,3-dihydropyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Anhydrosimvastatin (Impurity C) is an impurity of Simvastatin. Simvastatin is a competitive inhibitor of HMG-CoA reductase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.8±50.0 °C at 760 mmHg |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.551 |
| Flash Point | 265.6±28.5 °C |
| Exact Mass | 400.261353 |
| PSA | 52.60000 |
| LogP | 5.81 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | BIYWBTKPNWCYHM-RLSQPJRHSA-N |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC=CC(=O)O3)C21 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~4%
Dehydrosimvastatin CAS#:210980-68-0 |
| Literature: WO2005/40107 A2, ; Page/Page column 31-32; 61-62 ; |
|
Detail
|
| Literature: WO2005/40107 A2, ; Page/Page column 51-53 ; |
|
~%
Dehydrosimvastatin CAS#:210980-68-0 |
| Literature: WO2005/40107 A2, ; Page/Page column 73-74 ; |
|
~12%
Dehydrosimvastatin CAS#:210980-68-0
Detail
|
| Literature: WO2005/40107 A2, ; Page/Page column 45; 83 ; |
|
~0%
Dehydrosimvastatin CAS#:210980-68-0
Detail
|
| Literature: WO2005/40107 A2, ; Page/Page column 41-43; 80-82 ; |
|
~%
Dehydrosimvastatin CAS#:210980-68-0 |
| Literature: WO2005/40107 A2, ; Page/Page column 75-76 ; |
| Butanoic acid, 2,2-dimethyl-, (1S,3R,7S,8S,8aR)-8-[2-[(2R)-3,6-dihydro-6-oxo-2H-pyran-2-yl]ethyl]-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-1-naphthalenyl ester |
| anhydrosimvastatin |
| (1S,3R,7S,8S,8aR)-3,7-Dimethyl-8-{2-[(2R)-6-oxo-3,6-dihydro-2H-pyran-2-yl]ethyl}-1,2,3,7,8,8a-hexahydro-1-naphthalenyl 2,2-dimethylbutanoate |
| Dehydrosimvastatin |
| Dehydro Simvastatin |
| Anhydro-simvastatin |
| Simvastatin EP Impurity C |
| Dehydrosimvastatin |
| Simvastatin Impurity 3 |