10,11-Dehydrocurvularin structure
|
Common Name | 10,11-Dehydrocurvularin | ||
|---|---|---|---|---|
| CAS Number | 21178-57-4 | Molecular Weight | 290.31100 | |
| Density | 1.225 g/cm3 | Boiling Point | 576.3ºC at 760 mm | |
| Molecular Formula | C16H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
Use of 10,11-Dehydrocurvularin10,11-Dehydrocurvularin is a prevalent fungal phytotoxin and an antibiotic. 10,11-Dehydrocurvularin is a strong activator of the heat shock response. 10,11-Dehydrocurvularin inhibits TGF-β signalling pathway. Anti-tumorous activity[1][2]. |
| Name | (5S,9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-3,11-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 10,11-Dehydrocurvularin is a prevalent fungal phytotoxin and an antibiotic. 10,11-Dehydrocurvularin is a strong activator of the heat shock response. 10,11-Dehydrocurvularin inhibits TGF-β signalling pathway. Anti-tumorous activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.225 g/cm3 |
|---|---|
| Boiling Point | 576.3ºC at 760 mm |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31100 |
| Flash Point | 216.7ºC |
| Exact Mass | 290.11500 |
| PSA | 83.83000 |
| LogP | 2.49480 |
| Vapour Pressure | 7.02E-14mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | AVIRMQMUBGNCKS-GQCTYLIASA-N |
| SMILES | CC1CCCC=CC(=O)c2c(O)cc(O)cc2CC(=O)O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| trans-dehydrocurvularin |
| E-dehydrocurvularin |
| 10,11-dehydrocurvularin |
| 8-dehydrocurvularin |
| Dehydrocurvularin |
| AmbotzLS-1091 |