Tetrazine-SS-Biotin structure
|
Common Name | Tetrazine-SS-Biotin | ||
|---|---|---|---|---|
| CAS Number | 2123482-78-8 | Molecular Weight | 576.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N8O3S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tetrazine-SS-BiotinTetrazine-SS-Biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Tetrazine-SS-Biotin |
|---|
| Description | Tetrazine-SS-Biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C24H32N8O3S3 |
|---|---|
| Molecular Weight | 576.76 |
| InChIKey | DNUZQOORFCMFKQ-IPJJNNNSSA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCSSCCC(=O)NCc1ccc(-c2nncnn2)cc1 |