1H-Isoindole-1,3(2H)-dione,2-(1,1-dimethylethyl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 2141-99-3 | Molecular Weight | 203.23700 | |
| Density | 1.203g/cm3 | Boiling Point | 294.7ºC at 760mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5ºC | |
| Name | 2-tert-butylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 294.7ºC at 760mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 120.5ºC |
| Exact Mass | 203.09500 |
| PSA | 37.38000 |
| LogP | 2.01900 |
| Vapour Pressure | 0.00159mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | AMEZJARRAUZZHY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-tert-Butylphthalimide |
| 2-tert-butyl-isoindole-1,3-dione |
| 2-(tert-butyl)-isoindoline-1,3-dione |
| N-tertbutyl phtalimide |
| 2-tert-Butyl-1H-isoindole-1,3(2H)-dione |