1H-Isoindole-1,3(2H)-dione,2-(4-methoxyphenyl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2142-04-3 | Molecular Weight | 253.25300 | |
| Density | 1.327g/cm3 | Boiling Point | 443.1ºC at 760 mmHg | |
| Molecular Formula | C15H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.8ºC | |
| Name | 2-(4-methoxyphenyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 443.1ºC at 760 mmHg |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.25300 |
| Flash Point | 221.8ºC |
| Exact Mass | 253.07400 |
| PSA | 46.61000 |
| LogP | 2.56080 |
| Vapour Pressure | 4.76E-08mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | ZETLVSOYHDFNPZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| HS Code | 2925190090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(4-Methoxyphenyl)isoindoline-1,3-dione |
| N-(4-methoxyphenyl)phthalimide |
| 2-(2-PYRIDIN-4-YL-PYRROLIDIN-1-YL)-NICOTINIC ACID |
| 2-(4-Methoxyphenyl)-1H-isoindole-1,3(2H)-dione |
| 2-(4-methoxy-phenyl)isoindole-1,3-dione |
| N-(4-methoxybenzene)phthalimide |