PYRONINE B structure
|
Common Name | PYRONINE B | ||
|---|---|---|---|---|
| CAS Number | 2150-48-3 | Molecular Weight | 358.905 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27ClN2O | Melting Point | 174-176ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of PYRONINE BPyronin B is an organic cationic dye used for the staining of bacteria, mycobacteria and ribonucleic acids. Pyronin B is also used as a small hydrophobic (SH) protein channel inhibitor[1][2]. |
| Name | [6-(diethylamino)xanthen-3-ylidene]-diethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Pyronin B is an organic cationic dye used for the staining of bacteria, mycobacteria and ribonucleic acids. Pyronin B is also used as a small hydrophobic (SH) protein channel inhibitor[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Pyronin B (0-15 μM) inhibits channel activity of approximately 60% of small hydrophobic (SH) proteins at a concentration of 10 μM, and the Kd value of 6.8 μM[1]. Pyronin B (0-0.25 μM) affects RSV replication in Vero cells in a dose-dependent manner, and its TCID 50 (50% tissue culture infection dose) = 0 at the concentration of 0.25 μM[1]. Pyronin B (10 μM) can react with bromate in an oxidation reaction and the reaction rate increases dramatically with the addition of trace amounts of Ti (IV) with the characteristic absorption spectra of 555 nm[2]. |
| References |
| Melting Point | 174-176ºC |
|---|---|
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.905 |
| Exact Mass | 358.181183 |
| PSA | 19.39000 |
| LogP | 1.19980 |
| Appearance of Characters | crystals | Green needles or |
| InChIKey | CXZRDVVUVDYSCQ-UHFFFAOYSA-M |
| SMILES | CCN(CC)c1ccc2cc3ccc(=[N+](CC)CC)cc-3oc2c1.[Cl-] |
| Storage condition | Store at RT. |
| Water Solubility | Soluble in water, ethyl acetate, methyl acetate, ethylene glycol; slightly soluble in ethanol, methanol, methyl cellosolve |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R68 |
| Safety Phrases | S22;S45;S24/25;S36/S37 |
| RIDADR | NONH for all modes of transport |
| RTECS | BP6832000 |
|
~54%
PYRONINE B CAS#:2150-48-3 |
| Literature: WISTA LABORATORIES LTD.; CLUNAS, Scott; STRORY, John, Mervyn, David; RICKARD, Janet, Elizabeth; HORSLEY, David; HARRINGTON, Charles, Robert; WISCHIK, Claude, Michel Patent: WO2010/67078 A2, 2010 ; Location in patent: Page/Page column 65 ; |
|
~80%
PYRONINE B CAS#:2150-48-3 |
| Literature: Han, Shulei; Chen, Yi Dyes and Pigments, 2013 , vol. 96, # 1 p. 59 - 62 |
|
~%
Detail
Learn More
|
| Literature: Journal of the Chemical Society, , p. 244,247 |
|
Analysis and testing of biological stains--the Biological Stain Commission Procedures.
Biotech. Histochem. 77(5&6) , 237-275, (2002)
|
|
|
[Fluorescence investigation on interaction between artemisinin (qinghaosu) and hemin and its analytical application].
Guang Pu Xue Yu Guang Pu Fen Xi 26(9) , 1640-3, (2006) Hemin-catalytic decomposition of artemisinin (qinghaosu, QHS) was studied using pyronine B (PB) as an indicator. The interaction between hemin and QHS was an enzyme-substrate model, and the action sit... |
|
|
Nuclear dyes and cytoplasmic staining.
Cytometry 29(4) , 375-6, (1997)
|
| Ethanaminium, N-[6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-, chloride (1:1) |
| Ethanaminium, N-[6- (diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-, chloride |
| Pyronine B,purified |
| E tetraethylpyronin |
| [6-(Diethylamino)-3H-xanthen-3-ylidene]diethylammonium chloride |
| 3.6-Bis-diaethylamino-xanthylium-chlorid |
| Pyronin B |
| 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride |
| MFCD00011932 |
| Ammonium, [6- (diethylamino)-3H-xanthen-3-ylidene]diethyl-, chloride |
| EINECS 218-429-9 |
| 3,6-bis-diethylamino xanthylium chloride |
| PYRONINE B |