BRD4 ligand-Linker Conjugate 1 structure
|
Common Name | BRD4 ligand-Linker Conjugate 1 | ||
|---|---|---|---|---|
| CAS Number | 2154358-89-9 | Molecular Weight | 500.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H30ClN7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BRD4 ligand-Linker Conjugate 1BRD4 ligand-Linker Conjugate 1 is a target protein ligand-linker conjugate that can be used in the synthesis of PROTACs. |
| Name | BRD4 ligand-Linker Conjugate 1 |
|---|
| Description | BRD4 ligand-Linker Conjugate 1 is a target protein ligand-linker conjugate that can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H30ClN7 |
|---|---|
| Molecular Weight | 500.04 |
| InChIKey | NLXZLPYEKWQQAL-UHFFFAOYSA-N |
| SMILES | Cc1nnc2n1-c1ccc(-c3cnn(CCCCCCN)c3)cc1C(c1ccc(Cl)cc1)=NC21CC1 |
| Hazard Codes | Xi |
|---|