5-ROX structure
|
Common Name | 5-ROX | ||
|---|---|---|---|---|
| CAS Number | 216699-35-3 | Molecular Weight | 534.60200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-ROX5-ROX is a pure-5 isomer derived from carboxy-X-rhodamine. 5-ROX is a fluorescent oligonucleotide marker, acts as a donor molecule in FRET imaging coupled with porphyrins.5-ROX is widely used for oligonucleotide labeling and automated DNA sequencing applications.Excitation:575nm. Emission:575nm |
| Name | 3-Carboxy-4-(2,3,6,7,12,13,16,17-octahydro-1H,5H,11H,15H-pyrido[3 ,2,1-ij]quinolizino[1',9':6,7,8]chromeno[2,3-f]quinolin-4-ium-9-y l)benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | 5-ROX is a pure-5 isomer derived from carboxy-X-rhodamine. 5-ROX is a fluorescent oligonucleotide marker, acts as a donor molecule in FRET imaging coupled with porphyrins.5-ROX is widely used for oligonucleotide labeling and automated DNA sequencing applications.Excitation:575nm. Emission:575nm |
|---|---|
| Related Catalog |
| Molecular Formula | C33H30N2O5 |
|---|---|
| Molecular Weight | 534.60200 |
| Exact Mass | 534.21500 |
| PSA | 97.05000 |
| LogP | 5.12340 |
| InChIKey | UNGMOMJDNDFGJG-UHFFFAOYSA-N |
| SMILES | O=C([O-])c1ccc(C2=c3cc4c5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCC[N+]=5CCC4)c(C(=O)O)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-carboxy-X-rhodamine |
| 5-benzothiazoleacetic acid,2,3-dihydro-2-thioxo |
| 5-Benzothiazoleaceticacid,2,3-dihydro-2-thioxo-(9CI) |
| 5-carboxymethyl-2-thioxo-2,3-dihydrobenzothiazole |
| 5-ROX |