methyl 3,5-dibromo-2-hydroxybenzoate
methyl 3,5-dibromo-2-hydroxybenzoate structure
|
Common Name | methyl 3,5-dibromo-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 21702-79-4 | Molecular Weight | 309.93900 | |
| Density | 1.96g/cm3 | Boiling Point | 282.3ºC at 760mmHg | |
| Molecular Formula | C8H6Br2O3 | Melting Point | 146-156 °C | |
| MSDS | N/A | Flash Point | 124.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3,5-dibromo-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.96g/cm3 |
|---|---|
| Boiling Point | 282.3ºC at 760mmHg |
| Melting Point | 146-156 °C |
| Molecular Formula | C8H6Br2O3 |
| Molecular Weight | 309.93900 |
| Flash Point | 124.5ºC |
| Exact Mass | 307.86800 |
| PSA | 46.53000 |
| LogP | 2.70380 |
| Vapour Pressure | 0.00199mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | KISQISIKTRRMOX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 10 | |
CAS#:119-36-8
CAS#:67-56-1
CAS#:3147-55-5
CAS#:69-72-7
CAS#:74-88-4
CAS#:39075-92-8
CAS#:412313-55-4
CAS#:7726-95-6
CAS#:13130-23-9
CAS#:35763-16-7
CAS#:15790-59-7
CAS#:81963-79-3![(6E)-2,4-dibromo-6-[4-[(2-ethoxyanilino)methyl]-5-sulfanylidene-1,3,4-oxadiazolidin-2-ylidene]cyclohexa-2,4-dien-1-one structure](https://image.chemsrc.com/caspic/465/81963-85-1.png)
CAS#:81963-85-1
CAS#:81963-87-3![(6E)-2,4-dibromo-6-[4-[(N-methylanilino)methyl]-5-sulfanylidene-1,3,4-oxadiazolidin-2-ylidene]cyclohexa-2,4-dien-1-one structure](https://image.chemsrc.com/caspic/458/81963-90-8.png)
CAS#:81963-90-8![2-[[(5Z)-5-(3,5-dibromo-6-oxocyclohexa-2,4-dien-1-ylidene)-4-phenyl-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(3-methylphenyl)carbamoyl]acetamide structure](https://image.chemsrc.com/caspic/408/97399-29-6.png)
CAS#:97399-29-6![2-[[(5Z)-5-(3,5-dibromo-6-oxocyclohexa-2,4-dien-1-ylidene)-4-phenyl-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)carbamoyl]acetamide structure](https://image.chemsrc.com/caspic/053/97399-30-9.png)
CAS#:97399-30-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-Dibrom-2-hydroxy-benzoesaeure-methylester |
| 3,5-dibromo-2-hydroxymethyl benzoate |
| 3,5-dibromo-2-hydroxy-benzoic acid methyl ester |
| RARECHEM AL BF 0030 |
| 3,5-Dibromsalicylsaeuremethylester |
| MFCD00017534 |
| Methyl 3,5-Dibromosalicylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: Boiling point of methyl 3,5-dibromo-2-hydroxybenzoate is 282.3ºC at 760mmHg. |
| Q: What is the melting point of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: Melting point of methyl 3,5-dibromo-2-hydroxybenzoate is 146-156 °C. |
| Q: What is the safety information for methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: Safety information for methyl 3,5-dibromo-2-hydroxybenzoate: S24/25. |
| Q: What is the InChIKey of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: InChIKey of methyl 3,5-dibromo-2-hydroxybenzoate is KISQISIKTRRMOX-UHFFFAOYSA-N. |
| Q: What are the upstream materials of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: Related upstream materials(CAS) of methyl 3,5-dibromo-2-hydroxybenzoate: 119-36-8;67-56-1;3147-55-5;69-72-7;74-88-4;39075-92-8;412313-55-4;7726-95-6. |
| Q: What is the polar surface area (PSA) of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: Polar surface area (PSA) of methyl 3,5-dibromo-2-hydroxybenzoate is 46.53000. |
| Q: What is the CAS number of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: CAS number of methyl 3,5-dibromo-2-hydroxybenzoate is 21702-79-4. |
| Q: What is the SMILES notation of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: SMILES notation of methyl 3,5-dibromo-2-hydroxybenzoate is COC(=O)c1cc(Br)cc(Br)c1O. |
| Q: What is the English name of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: The English name of methyl 3,5-dibromo-2-hydroxybenzoate is methyl 3,5-dibromo-2-hydroxybenzoate. |
| Q: What is the molecular formula of methyl 3,5-dibromo-2-hydroxybenzoate? |
| A: Molecular formula of methyl 3,5-dibromo-2-hydroxybenzoate is C8H6Br2O3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |