methyl 3,5-dibromo-2-methoxybenzoate structure
|
Common Name | methyl 3,5-dibromo-2-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 15790-59-7 | Molecular Weight | 323.96600 | |
| Density | 1.763g/cm3 | Boiling Point | 336.2ºC at 760mmHg | |
| Molecular Formula | C9H8Br2O3 | Melting Point | 53-54ºC | |
| MSDS | N/A | Flash Point | 157.1ºC | |
| Name | methyl 3,5-dibromo-2-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.763g/cm3 |
|---|---|
| Boiling Point | 336.2ºC at 760mmHg |
| Melting Point | 53-54ºC |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.96600 |
| Flash Point | 157.1ºC |
| Exact Mass | 321.88400 |
| PSA | 35.53000 |
| LogP | 3.00680 |
| Vapour Pressure | 0.000114mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | SVSGXLZYOXVPCG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918990090 |
|
~99%
methyl 3,5-dibr... CAS#:15790-59-7 |
| Literature: ASTRAZENECA AB Patent: WO2006/121390 A2, 2006 ; Location in patent: Page/Page column 84-85 ; WO 2006/121390 A2 |
|
~%
methyl 3,5-dibr... CAS#:15790-59-7 |
| Literature: Journal of the American Chemical Society, , vol. 62, p. 2327,2333 |
|
~%
methyl 3,5-dibr... CAS#:15790-59-7 |
| Literature: Journal of the American Chemical Society, , vol. 62, p. 2327,2333 |
|
~%
methyl 3,5-dibr... CAS#:15790-59-7 |
| Literature: Gazzetta Chimica Italiana, , vol. 16, p. 421 |
|
~%
methyl 3,5-dibr... CAS#:15790-59-7 |
| Literature: Liebigs Annalen der Chemie, , p. 863 - 882 |
|
~%
methyl 3,5-dibr... CAS#:15790-59-7 |
| Literature: Gazzetta Chimica Italiana, , vol. 16, p. 421 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyldibromomethoxybenzenecarboxylate |
| RARECHEM AL BF 0876 |
| JS-121C |
| Methylaether-3.5-dibrom-salicylsaeure-methylester |
| 3,5-Dibrom-2-methoxy-benzoesaeure-methylester |
| 3,5-dibromo-2-methoxy-benzoic acid methyl ester |