Taraxeryl acetate structure
|
Common Name | Taraxeryl acetate | ||
|---|---|---|---|---|
| CAS Number | 2189-80-2 | Molecular Weight | 468.754 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 505.1±49.0 °C at 760 mmHg | |
| Molecular Formula | C32H52O2 | Melting Point | 303-305ºC | |
| MSDS | N/A | Flash Point | 256.2±17.4 °C | |
Use of Taraxeryl acetateTaraxerol acetate is a COX-1 and COX-2 inhibitor with IC50 values of 116.3 μM and 94.7 μM, respectively. Taraxerol acetate the has the anticancer potential and induces cell apoptosis[1]. |
| Name | taraxerol acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Taraxerol acetate is a COX-1 and COX-2 inhibitor with IC50 values of 116.3 μM and 94.7 μM, respectively. Taraxerol acetate the has the anticancer potential and induces cell apoptosis[1]. |
|---|---|
| Related Catalog | |
| Target |
COX-1:116.3 μM (IC50) COX-2:94.7 μM (IC50) |
| In Vitro | Taraxerol acetate(10-150 µM; 24 or 48 hours) induces a dose- and time-dependent cytotoxic effects in the U87 cells, exhibits IC50 values of 34.2 and 28.4 µM, at 24 and 48 h, respectively[2]. Taraxerol acetate(10, 50 and 150 µM; 24 hours) induces cell apoptosis, the percentage of apoptotic cells increased from 7.3% in the control cells, to 16.1, 44.1 and in the 10, 50 and 150 µM taraxerol acetate-treated cells, respectively. Furthermore, taraxerol acetate treatment led to sub-G1 cell cycle arrest with a corresponding decrease in the number of S-phase cells[2]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.1±49.0 °C at 760 mmHg |
| Melting Point | 303-305ºC |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.754 |
| Flash Point | 256.2±17.4 °C |
| Exact Mass | 468.396729 |
| PSA | 26.30000 |
| LogP | 11.95 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | YWJGYBXHXATAQY-MZVVBVDXSA-N |
| SMILES | CC(=O)OC1CCC2(C)C3CCC4(C)C(=CCC5(C)CCC(C)(C)CC54)C3(C)CCC2C1(C)C |
| Hazard Codes | Xi |
|---|
| Taraxerol monoacetate |
| 3-Picenol, 1,2,3,4,4a,5,6,6a,8,8a,9,10,11,12,12a,12b,13,14,14a,14b-eicosahydro-4,4,6a,8a,11,11,12b,14b-octamethyl-, acetate, (3S,4aR,6aR,8aR,12aR,12bS,14aR,14bR)- |
| Friedoolean-14-en-3-yl acetate |
| D-Friedoolean-14-en-3beta-yl acetate |
| Acetyl taraxerol |
| Taraxerol Acetate |
| Taraxenol acetate |
| (3S,4aR,6aR,8aR,12aR,12bS,14aR,14bR)-4,4,6a,8a,11,11,12b,14b-Octamethyl-1,2,3,4,4a,5,6,6a,8,8a,9,10,11,12,12a,12b,13,14,14a,14b-icosahydro-3-picenyl acetate |
| (3S,4aR,6aR,8aR,12aR,12bS,14aR,14bR)-4,4,6a,8a,11,11,12b,14b-Octamethyl-1,2,3,4,4a,5,6,6a,8,8a,9,10,11,12,12a,12b,13,14,14a,14b-icosahydropicen-3-yl acetate |
| taraxeryl acetate |