CDK1-IN-2 structure
|
Common Name | CDK1-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 220749-41-7 | Molecular Weight | 294.735 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 585.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.7±30.1 °C | |
Use of CDK1-IN-2CDK1-IN-2 is a CDK1 inhibitor (IC50: 5.8 μM)[1]. |
| Name | Cdk1 Inhibitor |
|---|---|
| Synonym | More Synonyms |
| Description | CDK1-IN-2 is a CDK1 inhibitor (IC50: 5.8 μM)[1]. |
|---|---|
| Related Catalog | |
| Target |
CDK1:5.8 μM (IC50) |
| In Vitro | CDK1-IN-2 (“CDK1 inhibitor 1”, 0-19.8 μM, 24 h) arrests HCT-116 cells in G2/M phase[1]. |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 585.1±50.0 °C at 760 mmHg |
| Molecular Formula | C17H11ClN2O |
| Molecular Weight | 294.735 |
| Flash Point | 307.7±30.1 °C |
| Exact Mass | 294.056000 |
| LogP | 4.02 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.778 |
| InChIKey | QJKBRWSJWQVKLY-LCYFTJDESA-N |
| SMILES | O=C1Nc2ccccc2C1=Cc1c(Cl)[nH]c2ccccc12 |
| Storage condition | 2-8°C |
| 2H-Indol-2-one, 3-[(2-chloro-1H-indol-3-yl)methylene]-1,3-dihydro-, (3E)- |
| (3E)-3-[(2-Chloro-1H-indol-3-yl)methylene]-1,3-dihydro-2H-indol-2-one |
| (3E)-3-[(2-chloro-1H-indol-3-yl)methylidene]-1,3-dihydro-2H-indol-2-one |
| Cdk1 Inhibitor |