Stigmastane-3,6-dione structure
|
Common Name | Stigmastane-3,6-dione | ||
|---|---|---|---|---|
| CAS Number | 22149-69-5 | Molecular Weight | 428.690 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 519.5±33.0 °C at 760 mmHg | |
| Molecular Formula | C29H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.5±22.4 °C | |
Use of Stigmastane-3,6-dione(5α)-Stigmastane-3,6-dione is a naturally occurring sterol that could be isolated from fruits of Ailanthus altissima Swingle. Antimicrobial Activity.[1]. |
| Name | Stigmastane-3,6-dione |
|---|---|
| Synonym | More Synonyms |
| Description | (5α)-Stigmastane-3,6-dione is a naturally occurring sterol that could be isolated from fruits of Ailanthus altissima Swingle. Antimicrobial Activity.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 519.5±33.0 °C at 760 mmHg |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.690 |
| Flash Point | 191.5±22.4 °C |
| Exact Mass | 428.365417 |
| PSA | 34.14000 |
| LogP | 8.37 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | HMMVBUVVQLUGQA-UMQMBAGDSA-N |
| SMILES | CCC(CCC(C)C1CCC2C3CC(=O)C4CC(=O)CCC4(C)C3CCC12C)C(C)C |
| Hazard Codes | Xi |
|---|
| Stigmastane-3,6-dione |