1,4-Naphthalenedione,2-amino-3-hydroxy structure
|
Common Name | 1,4-Naphthalenedione,2-amino-3-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 22158-41-4 | Molecular Weight | 189.16700 | |
| Density | 1.536g/cm3 | Boiling Point | 372.6ºC at 760mmHg | |
| Molecular Formula | C10H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.1ºC | |
| Name | 3-amino-4-hydroxynaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.536g/cm3 |
|---|---|
| Boiling Point | 372.6ºC at 760mmHg |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.16700 |
| Flash Point | 179.1ºC |
| Exact Mass | 189.04300 |
| PSA | 80.39000 |
| LogP | 1.49420 |
| Vapour Pressure | 3.28E-06mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | XQQDQBRCPNTKQZ-UHFFFAOYSA-N |
| SMILES | NC1=C(O)c2ccccc2C(=O)C1=O |
| HS Code | 2922509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-3-hydroxynaphthoquinone |
| 3-amino-2-hydroxy-1,4-naphthoquinone |
| 2-Amino-3-hydroxy-[1,4]naphthochinon |
| 3-Amino-2-hydroxy-naphthochinon-(1,4) |
| 2-amino-3-hydroxy-1,4-naphthoquinone |
| 2-hydroxy-3-amino-1,4-naphthoquinone |