ethylene di(thiotosylate) structure
|
Common Name | ethylene di(thiotosylate) | ||
|---|---|---|---|---|
| CAS Number | 2225-23-2 | Molecular Weight | 402.57200 | |
| Density | 1.367g/cm3 | Boiling Point | 580.2ºC at 760mmHg | |
| Molecular Formula | C16H18O4S4 | Melting Point | 72-75ºC(lit.) | |
| MSDS | N/A | Flash Point | 304.7ºC | |
| Name | 1-methyl-4-[2-(4-methylphenyl)sulfonylsulfanylethylsulfanylsulfonyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 580.2ºC at 760mmHg |
| Melting Point | 72-75ºC(lit.) |
| Molecular Formula | C16H18O4S4 |
| Molecular Weight | 402.57200 |
| Flash Point | 304.7ºC |
| Exact Mass | 402.00900 |
| PSA | 135.64000 |
| LogP | 6.00900 |
| Vapour Pressure | 7.49E-13mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | DUFUGAKEFZRFEQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)SCCSS(=O)(=O)c2ccc(C)cc2)cc1 |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2930909090 |
|
~97%
ethylene di(thi... CAS#:2225-23-2 |
| Literature: Deguest, Geoffrey; Bischoff, Laurent; Fruit, Corinne; Marsais, Francis Synthetic Communications, 2008 , vol. 38, # 6 p. 841 - 847 |
|
~%
ethylene di(thi... CAS#:2225-23-2 |
| Literature: Chemical and pharmaceutical bulletin, , vol. 15, # 9 p. 1310 - 1314 |
|
~%
ethylene di(thi... CAS#:2225-23-2 |
| Literature: Chemische Berichte, , vol. 20, p. 2082 Chemische Berichte, , vol. 25, p. 1478 |
|
~%
ethylene di(thi... CAS#:2225-23-2 |
| Literature: Chemical and pharmaceutical bulletin, , vol. 12, # 11 p. 1271 - 1276 |
|
~%
ethylene di(thi... CAS#:2225-23-2 |
| Literature: Synthetic Communications, , vol. 20, # 14 p. 2151 - 2164 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethylene Bis(p-toluenethiosulfonate) |
| 1,2-Di(p-tosylthio)ethane |
| EINECS 218-752-5 |
| 1,2-Ethanedithiol Ditosylate |
| toluene-4-thiosulfonic acid S,S'-ethane-1,2-diyl ester |
| ETHYLENE DI(THIOTOSYLATE) |
| S,S'-Ethylene p-Toluenethiosulfonate |