FKBP12 Ligand
Modify Date: 2025-09-04 13:49:07
FKBP12 Ligand structure
|
Common Name | FKBP12 Ligand | ||
|---|---|---|---|---|
| CAS Number | 2230613-03-1 | Molecular Weight | 693.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H47NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FKBP12 LigandPROTAC FKBP12 Ligand 1 can be used for synthesis of dTAG molecules. dTAG molecules selectively degrade FKBP12. |
| Name | PROTAC FKBP12 Ligand 1 |
|---|
| Description | PROTAC FKBP12 Ligand 1 can be used for synthesis of dTAG molecules. dTAG molecules selectively degrade FKBP12. |
|---|---|
| Related Catalog | |
| In Vitro | FKBP12 recruits CRBN1 by heterobifunctional degraders. |
| References |
| Molecular Formula | C38H47NO11 |
|---|---|
| Molecular Weight | 693.78 |
| InChIKey | UYXSZUBFOQLRNQ-BTIIJPOSSA-N |
| SMILES | CCC(C(=O)N1CCCCC1C(=O)OC(CCc1ccc(OC)c(OC)c1)c1ccccc1OCC(=O)O)c1cc(OC)c(OC)c(OC)c1 |