7-Methoxyflavone structure
|
Common Name | 7-Methoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 22395-22-8 | Molecular Weight | 252.26 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 421.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | 110-112 °C(lit.) | |
| MSDS | N/A | Flash Point | 200.3±15.1 °C | |
Use of 7-Methoxyflavone7-Methoxyflavone is a compound isolated from Zornia brasiliensis. 7-Methoxyflavone has peripheral antinociceptive activity. 7-Methoxyflavone inhibits paw-licking time in the neurogenic phase of the formalin pain response (65.6%) and did not decrease the nociceptive response in the inflammatory phase[1]. |
| Name | 7-methoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Methoxyflavone is a compound isolated from Zornia brasiliensis. 7-Methoxyflavone has peripheral antinociceptive activity. 7-Methoxyflavone inhibits paw-licking time in the neurogenic phase of the formalin pain response (65.6%) and did not decrease the nociceptive response in the inflammatory phase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.2±45.0 °C at 760 mmHg |
| Melting Point | 110-112 °C(lit.) |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26 |
| Flash Point | 200.3±15.1 °C |
| Exact Mass | 252.078644 |
| PSA | 39.44000 |
| LogP | 3.47 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | QKNDCRMJDZLFEG-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)cc(-c3ccccc3)oc2c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4H-1-Benzopyran-4-one, 7-methoxy-2-phenyl- |
| 7-methoxyflavone |
| MFCD00017462 |
| 7-Methoxy-2-phenyl-4H-1-benzopyran-4-one |
| 7-methoxoyflavone |
| 7-methoxy-2-phenyl-chromen-4-one |
| METHOXYFLAVONE,7 |
| 8-methoxyflavone |
| 7-Methoxy-2-phenyl-4H-chromen-4-one |