Mordant Yellow 3R structure
|
Common Name | Mordant Yellow 3R | ||
|---|---|---|---|---|
| CAS Number | 2243-76-7 | Molecular Weight | 287.228 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 571.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H9N3O5 | Melting Point | 250°C | |
| MSDS | Chinese USA | Flash Point | 299.4±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Mordant Yellow 3RAlizarine Yellow R (Mordant orange 1), a salicylic acid derivative, is a azo dye. Alizarine Yellow R is mostly used as a pH indicator, as a biological stain in chemical examinations and also in dyeing industries[1]. |
| Name | (3E)-3-[(4-nitrophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Alizarine Yellow R (Mordant orange 1), a salicylic acid derivative, is a azo dye. Alizarine Yellow R is mostly used as a pH indicator, as a biological stain in chemical examinations and also in dyeing industries[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 571.4±50.0 °C at 760 mmHg |
| Melting Point | 250°C |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.228 |
| Flash Point | 299.4±30.1 °C |
| Exact Mass | 287.054230 |
| PSA | 128.07000 |
| LogP | 4.26 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | YVJPMMYYRNHJAU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(N=Nc2ccc([N+](=O)[O-])cc2)ccc1O |
| Water Solubility | SOLUBLE |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S24/25-S26 |
| RIDADR | NONH for all modes of transport |
| RTECS | VO5310000 |
| HS Code | 2901100000 |
|
~%
Mordant Yellow 3R CAS#:2243-76-7 |
| Literature: Journal of the Chemical Society, , vol. 79, p. 50 |
|
~%
Mordant Yellow 3R CAS#:2243-76-7 |
| Literature: Journal of the Chemical Society, , vol. 47, p. 661 |
|
~%
Mordant Yellow 3R CAS#:2243-76-7 |
| Literature: Chemische Berichte, , vol. 40, p. 3453 |
|
~%
Mordant Yellow 3R CAS#:2243-76-7 |
| Literature: Chemische Berichte, , vol. 40, p. 3453 Journal fuer Praktische Chemie (Leipzig), , vol. <2>78, p. 402 Chemische Berichte, , vol. 40, p. 3454 |
|
~%
Mordant Yellow 3R CAS#:2243-76-7 |
| Literature: Journal of the Chemical Society, , vol. 79, p. 50 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Alizarine Yellow R |
| Alizarol Orange R |
| EINECS 217-002-4 |
| Mordant Yellow 3R |
| 5-[(E)-2-(4-nitrophenyl)-1-diazenyl]-2-hydroxybenzoic acid |
| 5-(4-Nitrophenylazo)salicylic Acid |
| Kenachrome Orange |
| Alizarin yellow R |
| Terracotta 2RN |
| Terra Cotta RRN |
| Chrome Orange R |
| Chrome Orange N |
| 2-Hydroxy-5-[(4-nitrophenyl)azo]benzoic Acid |
| C.I. Mordant Orange I |
| 5-(4-nitrophenylazo) salicylic acid |
| 5-(4-Nitrophenylazo)salicylic acid Alizarin Yellow R MO1 |
| MFCD00067121 |
| mordant orange 1 |
| Pnbas |
| Chrome Orange MR |
| 2-Hydroxy-5-[(E)-(4-nitrophenyl)diazenyl]benzoic acid |
| Benzoic acid, 2-hydroxy-5-[(E)-2-(4-nitrophenyl)diazenyl]- |
| benzoic acid, 2-hydroxy-5-[(E)-(4-nitrophenyl)azo]- |
| Magracrom Orange |
| p-Nitrobenzeneazosalicylic Acid |