BCL6-IN-5 structure
|
Common Name | BCL6-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 2253878-09-8 | Molecular Weight | 396.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19Cl2N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BCL6-IN-5BCL6-IN-5 is a potent BCL6 inhibitor exacted from patent WO2018215801A1, example 1n, has a pIC50 of 5.82[1]. |
| Name | BCL6-IN-5 |
|---|
| Description | BCL6-IN-5 is a potent BCL6 inhibitor exacted from patent WO2018215801A1, example 1n, has a pIC50 of 5.82[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Benjamin Richard BELLENIE, et al. Benzimidazolone derived inhibitors of bcl6. WO2018215801A1. |
| Molecular Formula | C17H19Cl2N5O2 |
|---|---|
| Molecular Weight | 396.27 |
| InChIKey | NKMQWLPBEJJYCN-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)n(CCC(C)(C)O)c2cc(Nc3nc(Cl)ncc3Cl)ccc21 |