Benzeneethanol,2-methyl-, 1-(3,5-dinitrobenzoate) structure
|
Common Name | Benzeneethanol,2-methyl-, 1-(3,5-dinitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 22545-17-1 | Molecular Weight | 330.29200 | |
| Density | 1.35g/cm3 | Boiling Point | 502ºC at 760mmHg | |
| Molecular Formula | C16H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | 2-(2-methylphenyl)ethyl 3,5-dinitrobenzoate |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 502ºC at 760mmHg |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.29200 |
| Flash Point | 213.9ºC |
| Exact Mass | 330.08500 |
| PSA | 117.94000 |
| LogP | 4.25730 |
| Vapour Pressure | 3.3E-10mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | ODXFOSVXDPORLQ-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CCOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
Benzeneethanol,... CAS#:22545-17-1 |
| Literature: Drake; McVey Journal of Organic Chemistry, 1939 , vol. 4, p. 464,468 |
|
~%
Benzeneethanol,... CAS#:22545-17-1 |
| Literature: Drake; McVey Journal of Organic Chemistry, 1939 , vol. 4, p. 464,468 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |