Pomalidomide 4'-PEG3-azide structure
|
Common Name | Pomalidomide 4'-PEG3-azide | ||
|---|---|---|---|---|
| CAS Number | 2271036-46-3 | Molecular Weight | 474.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pomalidomide 4'-PEG3-azidePomalidomide 4'-PEG3-azide is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide-based cereblon ligand and a linker. Pomalidomide 4'-PEG3-azide can be used for the synthesis of iRucaparib-TP3 (Compound 3). iRucaparib-TP3 is a highly efficient PARP1 degrader based on Rucaparib by using the PROTAC approach[1]. |
| Name | Pomalidomide 4'-PEG3-azide |
|---|
| Description | Pomalidomide 4'-PEG3-azide is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide-based cereblon ligand and a linker. Pomalidomide 4'-PEG3-azide can be used for the synthesis of iRucaparib-TP3 (Compound 3). iRucaparib-TP3 is a highly efficient PARP1 degrader based on Rucaparib by using the PROTAC approach[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| References |
| Molecular Formula | C21H26N6O7 |
|---|---|
| Molecular Weight | 474.47 |
| InChIKey | IRPMZWZENVORCT-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Storage condition | 2-8°C |