CEM114 structure
|
Common Name | CEM114 | ||
|---|---|---|---|---|
| CAS Number | 2279062-54-1 | Molecular Weight | 1612.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C84H122FN9O19S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CEM114CEM114 is an effective chemical epigenetic modifier (CEM) that recruits endogenous chromatin machinery through CRISPR-Cas9 systems[1]. |
| Name | CEM114 |
|---|
| Description | CEM114 is an effective chemical epigenetic modifier (CEM) that recruits endogenous chromatin machinery through CRISPR-Cas9 systems[1]. |
|---|---|
| Related Catalog | |
| In Vitro | CEM114 (200 nM; 48 hours) treatment significantly activates the Green Fluorescent Protein (GFP) signal, suggesting that excess FK506 is able to outcompete CEM114 from the FKBP binding site[1]. Cell Viability Assay[1] Cell Line: HEK 293T cells Concentration: 200 nM Incubation Time: 48 hours Result: Significantly activated the GFP signal. |
| References |
| Molecular Formula | C84H122FN9O19S |
|---|---|
| Molecular Weight | 1612.98 |
| InChIKey | JPTHTRDMYPXUQU-GWBWRJFESA-N |
| SMILES | COC1CC(C=C(C)C2OC(=O)C3CCCCN3C(=O)C(=O)C3(O)OC(C(OC)CC(C)CC(C)=CC(CCCSCCC(=O)NCCOCCOCCOCCn4cc(COc5ccc(CCc6nc7cc(-c8c(C)noc8C)ccc7n6CCN6CCOCC6)cc5F)nn4)C(=O)CC(O)C2C)C(OC)CC3C)CCC1O |