4-Chloro-3-nitro-5-sulphamoylbenzoic acid structure
|
Common Name | 4-Chloro-3-nitro-5-sulphamoylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 22892-96-2 | Molecular Weight | 280.642 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 563.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C7H5ClN2O6S | Melting Point | 227-231ºC | |
| MSDS | Chinese USA | Flash Point | 294.6±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-3-nitro-5-sulfamoylbenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 563.5±60.0 °C at 760 mmHg |
| Melting Point | 227-231ºC |
| Molecular Formula | C7H5ClN2O6S |
| Molecular Weight | 280.642 |
| Flash Point | 294.6±32.9 °C |
| Exact Mass | 279.955688 |
| PSA | 151.66000 |
| LogP | 1.13 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | ACYLUAGCBGTEJF-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Ultrasound mediated catalyst free synthesis of 6H-1-benzopyrano[4,3-b]quinolin-6-ones leading to novel quinoline derivatives: their evaluation as potential anti-cancer agents.
Bioorg. Med. Chem. 20 , 759-68, (2012) A facile and catalyst free synthesis of 6H-1-benzopyrano[4,3-b]quinolin-6-ones has been accomplished via the reaction of 4-chloro-2-oxo-2H-chromene-3-carbaldehyde with various aromatic amines in the p... |
| 4-Chloro-3-nitro-5-sulfamoylbenzoic acid |
| EINECS 245-310-9 |
| MFCD00058688 |
| 4-Chloro-3-nitro-5-sulfamoylbenzoicAcid |
| 4-Chloro-3-nitro-5-sulfamoyl benzoic acid |