3-nitro-4-phenoxy-5-sulphamoylbenzoic acid structure
|
Common Name | 3-nitro-4-phenoxy-5-sulphamoylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 28328-53-2 | Molecular Weight | 338.293 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 547.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C13H10N2O7S | Melting Point | 251-253°C (dec.) | |
| MSDS | N/A | Flash Point | 285.0±32.9 °C | |
| Name | bumetanide related compound b (25 mg) (3-nitro-4-phenoxy-5-sulfamoylbenzoic acid) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 547.6±60.0 °C at 760 mmHg |
| Melting Point | 251-253°C (dec.) |
| Molecular Formula | C13H10N2O7S |
| Molecular Weight | 338.293 |
| Flash Point | 285.0±32.9 °C |
| Exact Mass | 338.020874 |
| PSA | 160.89000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | NXJUSSNAIUIVKY-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1Oc1ccccc1 |
| Storage condition | Refrigerator |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2935009090 |
|
~38%
3-nitro-4-pheno... CAS#:28328-53-2 |
| Literature: CONCERT PHARMACEUTICALS INC.; Tung, Roger Patent: US2014/128469 A1, 2014 ; Location in patent: Paragraph 0110; 0111 ; |
|
~%
3-nitro-4-pheno... CAS#:28328-53-2 |
| Literature: AUSPEX PHARMACEUTICALS, INC. Patent: US2008/262086 A1, 2008 ; Location in patent: Page/Page column 27 ; |
|
~%
3-nitro-4-pheno... CAS#:28328-53-2 |
| Literature: Hoechst Aktiengesellschaft Patent: US4010273 A1, 1977 ; |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 3-Nitro-4-phenoxy-5-sulphamoylbenzoic acid |
| 3-Nitro-4-phenoxy-5-sulfamyl-benzoesaeure |
| 3-Nitro-4-oxy-phenylarsinigsaeure-anhydrid |
| Phenol,4-arsenoso-2-nitro |
| 4-Arsenoso-2-nitrophenol |
| 3-Nitro-4-hydroxyphenylarsenous acid |
| 3-Nitro-4-phenoxy-5-sulfamoyl-benzoesaeure |
| 3-nitro-4-phenoxy-5-sulfamylbenzoic acid |
| 3-Nitro-4-phenoxy-5-sulfamoylbenzoic acid |
| 3-nitro-4-phenoxy-5-sulphamylbenzoic acid |
| 3-Nitro-4-oxy-phenylarsenoxyd |