5-AMINO-3-AMINOSULFONY-4-PHENOXYBENZOICACID structure
|
Common Name | 5-AMINO-3-AMINOSULFONY-4-PHENOXYBENZOICACID | ||
|---|---|---|---|---|
| CAS Number | 28328-54-3 | Molecular Weight | 308.31000 | |
| Density | 1.512g/cm3 | Boiling Point | 555.3ºC at 760mmHg | |
| Molecular Formula | C13H12N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.6ºC | |
| Name | 3-amino-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.512g/cm3 |
|---|---|
| Boiling Point | 555.3ºC at 760mmHg |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31000 |
| Flash Point | 289.6ºC |
| Exact Mass | 308.04700 |
| PSA | 141.09000 |
| LogP | 3.76900 |
| Vapour Pressure | 3.65E-13mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | GVQZPZSQRCXSJI-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2935009090 |
|
~75%
5-AMINO-3-AMINO... CAS#:28328-54-3 |
| Literature: AUSPEX PHARMACEUTICALS, INC. Patent: US2008/262086 A1, 2008 ; Location in patent: Page/Page column 28 ; |
|
~%
5-AMINO-3-AMINO... CAS#:28328-54-3 |
| Literature: Lovens Kemiske Fabrik Produktionsaktieselskab Patent: US3971819 A1, 1976 ; |
|
~%
5-AMINO-3-AMINO... CAS#:28328-54-3 |
| Literature: NEUROTHERAPEUTICS PHARMA, INC.; WANASKI, Stephen; COLLINS, Stephen; KINCAID, John Patent: WO2012/18635 A2, 2012 ; WO 2012/018635 A2 |
|
~%
5-AMINO-3-AMINO... CAS#:28328-54-3 |
| Literature: NEUROTHERAPEUTICS PHARMA, INC.; WANASKI, Stephen; COLLINS, Stephen; KINCAID, John Patent: WO2012/18635 A2, 2012 ; WO 2012/018635 A2 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Bumetanide impurity B |
| Desbutylbumetanide |
| 3-sulphamoyl-4-phenoxy-5-amino-benzoic acid |
| 3-amino-4-phenoxy-5-sulphamyl-benzoic acid |
| 3-amino-4-phenoxy-5-sulfamylbenzoic acid |
| EINECS 248-971-1 |
| 3-amino-4-phenoxy-5-sulfamoyl-benzoic acid |