Ethyl 4-chloro-6-methoxy-3-quinolinecarboxylate structure
|
Common Name | Ethyl 4-chloro-6-methoxy-3-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 22931-71-1 | Molecular Weight | 265.69200 | |
| Density | 1.282g/cm3 | Boiling Point | 366.9ºC at 760mmHg | |
| Molecular Formula | C13H12ClNO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 175.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Ethyl 4-chloro-6-methoxy-3-quinolinecarboxylate |
| Name | ethyl 4-chloro-6-methoxyquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 366.9ºC at 760mmHg |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.69200 |
| Flash Point | 175.7ºC |
| Exact Mass | 265.05100 |
| PSA | 48.42000 |
| LogP | 3.07350 |
| Vapour Pressure | 1.42E-05mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | QURGQUFEJWWDRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2ccc(OC)cc2c1Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
| HS Code | 2933499090 |
|
~60%
Ethyl 4-chloro-... CAS#:22931-71-1 |
| Literature: Aventis Pharma S.A. Patent: US2005/182259 A1, 2005 ; Location in patent: Page/Page column 5 ; |
|
~99%
Ethyl 4-chloro-... CAS#:22931-71-1 |
| Literature: SENOMYX, INC.; TACHDJIAN, Catherine; TANG, Xiao Qing; KARANEWSKY, Donald S.; SERVANT, Guy; LI, Xiaodong; ZHANG, Feng; CHEN, Qing; ZHANG, Hong; DAVIS, Timothy; DARMOHUSODO, Vincent; WONG, Melissa; SELCHAU, Victor Patent: WO2013/25560 A1, 2013 ; Location in patent: Page/Page column 52; 53 ; |
|
~%
Ethyl 4-chloro-... CAS#:22931-71-1 |
| Literature: Farmaco, , vol. 53, # 8-9 p. 579 - 585 |
|
~%
Ethyl 4-chloro-... CAS#:22931-71-1 |
| Literature: European Journal of Medicinal Chemistry, , vol. 46, # 4 p. 1448 - 1452 |
|
~%
Ethyl 4-chloro-... CAS#:22931-71-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 36, # 11 p. 1669 - 1673 |
|
~%
Ethyl 4-chloro-... CAS#:22931-71-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 7 p. 3578 - 3582 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chlor-6-methoxy-3-chinolincarbonsaeure-ethylester |
| 4-Chloro-6-methoxyquinoline-3-carboxylic acid ethyl ester |
| ethyl 4-chloro-6-methoxyquinolin-3-carboxylate |
| Ethyl 4-chloro-6-methoxy-quinoline-3-carboxylate |
| 4-Chlor-6-methoxy-chinolin-3-carbonsaeure-aethylester |
| 4-chloro-6-methoxy-quinoline-3-carboxylic acid ethyl ester |
| Ethyl 4-chloro-6-methoxy-3-quinolinecarboxylate |
| 4-Chloro-3-ethoxycarbonyl-6-methoxyquinoline |
| MFCD00173417 |
| GNF-Pf-3551 |