Ethyl 4-chloro-8-methoxy-3-quinolinecarboxylate structure
|
Common Name | Ethyl 4-chloro-8-methoxy-3-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 27568-05-4 | Molecular Weight | 265.692 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 366.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C13H12ClNO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 175.7±26.5 °C | |
| Name | ethyl 4-chloro-8-methoxyquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.9±37.0 °C at 760 mmHg |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.692 |
| Flash Point | 175.7±26.5 °C |
| Exact Mass | 265.050568 |
| PSA | 48.42000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | BBOZDELEERNECG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BB_SC-2530 |
| 4-chloro-8-methoxy-quinoline-3-carboxylic acid ethyl ester |
| Ethyl 4-chloro-8-methoxy-3-quinolinecarboxylate |
| ethyl 8-methoxy-4-chloroquinoline-3-carboxylate |
| 4-Chloro-8-Methoxy-3-Quinolinecarboxylicacid Ethyl Ester |
| 4-Chloro-8-methoxyquinoline-3-carboxylic acid ethyl ester |
| 3-Quinolinecarboxylic acid, 4-chloro-8-methoxy-, ethyl ester |