Dimethyl 4-methoxyisophthalate structure
|
Common Name | Dimethyl 4-methoxyisophthalate | ||
|---|---|---|---|---|
| CAS Number | 22955-73-3 | Molecular Weight | 224.21000 | |
| Density | 1.184g/cm3 | Boiling Point | 331.6ºC at 760 mmHg | |
| Molecular Formula | C11H12O5 | Melting Point | 93-97ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | dimethyl 4-methoxybenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 331.6ºC at 760 mmHg |
| Melting Point | 93-97ºC |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21000 |
| Exact Mass | 224.06800 |
| PSA | 61.83000 |
| LogP | 1.26840 |
| Vapour Pressure | 0.000154mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | VYLTWLWJTAJDSS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC)c(C(=O)OC)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| dimethyl-4-methoxyisophthalate |
| MFCD06204071 |
| EINECS 245-350-7 |
| 4-Methoxyisophthalsaeure-dimethylester |
| 4-methoxy-1,3-benzenedicarboxylic acid dimethyl ester |
| 4-methoxy-isophthalic acid dimethyl ester |