DIMETHYL (4-NITROBENZYLIDENE)MALONATE structure
|
Common Name | DIMETHYL (4-NITROBENZYLIDENE)MALONATE | ||
|---|---|---|---|---|
| CAS Number | 38323-22-7 | Molecular Weight | 265.21900 | |
| Density | 1.335g/cm3 | Boiling Point | 336.4ºC at 760 mmHg | |
| Molecular Formula | C12H11NO6 | Melting Point | 137-139ºC(lit.) | |
| MSDS | N/A | Flash Point | 135ºC | |
| Name | dimethyl 2-[(4-nitrophenyl)methylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 336.4ºC at 760 mmHg |
| Melting Point | 137-139ºC(lit.) |
| Molecular Formula | C12H11NO6 |
| Molecular Weight | 265.21900 |
| Flash Point | 135ºC |
| Exact Mass | 265.05900 |
| PSA | 98.42000 |
| LogP | 1.84740 |
| Index of Refraction | 1.578 |
| InChIKey | WKQDFBKYIAEZEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=Cc1ccc([N+](=O)[O-])cc1)C(=O)OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917399090 |
|
~85%
DIMETHYL (4-NIT... CAS#:38323-22-7 |
| Literature: Mase, Nobuyuki; Horibe, Takuya Organic Letters, 2013 , vol. 15, # 8 p. 1854 - 1857 |
|
~89%
DIMETHYL (4-NIT... CAS#:38323-22-7 |
| Literature: Herrmann, Wolfgang A.; Wang, Mei Angewandte Chemie, 1991 , vol. 103, # 12 p. 1709 - 1711 |
|
~%
DIMETHYL (4-NIT... CAS#:38323-22-7 |
| Literature: Baker; Eccles Journal of the Chemical Society, 1927 , p. 2129 |
|
~%
DIMETHYL (4-NIT... CAS#:38323-22-7 |
| Literature: Baker; Eccles Journal of the Chemical Society, 1927 , p. 2129 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Propanedioic acid,[(4-nitrophenyl)methylene]-,dimethyl ester |
| dimethyl (4-nitrobenzylidene)-malonate |
| dimethyl (p-nitrobenzylidene)malonate |
| Dimethyl 2-(4-nitrobenzylidene)malonate |
| 1,3-dimethyl 2-(4-nitrobenzylidene)malonate |
| dimethyl 2-[(4-nitrophenyl)methylene]propane-1,3-dioate |
| 2-Carbomethoxy-3-(4-nitrophenyl)propenoic acid methyl ester |
| MFCD00074999 |