Di(trimethylolpropane) structure
|
Common Name | Di(trimethylolpropane) | ||
|---|---|---|---|---|
| CAS Number | 23235-61-2 | Molecular Weight | 250.332 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 435.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H26O5 | Melting Point | 108-111ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 217.2±27.3 °C | |
| Name | Di(trimethylol propane) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.6±40.0 °C at 760 mmHg |
| Melting Point | 108-111ºC(lit.) |
| Molecular Formula | C12H26O5 |
| Molecular Weight | 250.332 |
| Flash Point | 217.2±27.3 °C |
| Exact Mass | 250.178024 |
| PSA | 90.15000 |
| LogP | 0.21 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | WMYINDVYGQKYMI-UHFFFAOYSA-N |
| SMILES | CCC(CO)(CO)COCC(CC)(CO)CO |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909499000 |
|
~%
Di(trimethylolp... CAS#:23235-61-2 |
| Literature: US2014/135536 A1, ; Paragraph 0088-0089 ; |
|
~%
Di(trimethylolp... CAS#:23235-61-2 |
| Literature: Organic Process Research and Development, , vol. 5, # 6 p. 568 - 571 |
|
~10%
Di(trimethylolp... CAS#:23235-61-2 |
| Literature: Frey, Guido D.; Dewhurst, Rian D.; Herdtweckc, Eberhardt Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2012 , vol. 67, # 2 p. 181 - 184 |
|
~19%
Di(trimethylolp... CAS#:23235-61-2 |
| Literature: Mitsubishi Gas Chemical Company, Inc. Patent: EP2204356 A1, 2010 ; Location in patent: Page/Page column 9 ; |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2,2'-diethyl-2,2'-(2-oxa-propane-1,3-diyl)-bis-propane-1,3-diol |
| 1,3-Propanediol, 2,2'-[oxybis(methylene)]bis[2-ethyl- |
| 2,2'-(oxydimethanediyl)bis(2-ethylpropane-1,3-diol) |
| 1,3-Propanediol, 2,2'-(oxybis(methylene))bis(2-ethyl- |
| 1,3-Propanediol,2,2-oxybis(methylene)bis2-ethyl |
| Einecs 245-509-0 |
| Ditrimethylol |
| 2,2'-[Oxybis(methylene)]bis(2-ethylpropane-1,3-diol) |
| 2,2'-[Oxybis(methylene)]bis(2-ethyl-1,3-propanediol) |
| DI(TRIMETHYLOLPROPANE) |
| Perstorp Di-Trimethylolpropane |
| DTMP |
| Bis[2,2-di(hydroxymethyl)butyl] ether |
| 2,2'-Oxybis(methylene)bis(2-ethyl-1,3-propanediol) |
| 2,2,2',2'-(tetrahydroxymethyl)-dibutyl ether |
| 3,3,7,7-tetra(hydroxymethyl)-5-oxanonane |
| Bis[2-ethyl-2,2-bis(hydroxymethyl)ethyl] Ether |
| 2,2'-(Oxybis(methylene))bis(2-ethylpropane-1,3-diol) |
| MFCD00192117 |