2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide structure
|
Common Name | 2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide | ||
|---|---|---|---|---|
| CAS Number | 23316-67-8 | Molecular Weight | 471.45800 | |
| Density | 1.35 g/cm3 | Boiling Point | 643.1ºC at 760 mmHg | |
| Molecular Formula | C27H21NO7 | Melting Point | 65-75 °C | |
| MSDS | N/A | Flash Point | 272.4ºC | |
| Name | 2,3,5-Tri-O-benzoyl-β-D-ribofuranosyl cyanide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35 g/cm3 |
|---|---|
| Boiling Point | 643.1ºC at 760 mmHg |
| Melting Point | 65-75 °C |
| Molecular Formula | C27H21NO7 |
| Molecular Weight | 471.45800 |
| Flash Point | 272.4ºC |
| Exact Mass | 471.13200 |
| PSA | 111.92000 |
| LogP | 3.58558 |
| Vapour Pressure | 1.96E-16mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | OFMYTVNDIRTGMR-UARRHKHWSA-N |
| SMILES | N#CC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 36 |
| WGK Germany | 3 |
| HS Code | 2932190090 |
| Precursor 7 | |
|---|---|
| DownStream 7 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (2R,3R,4S,5S)-2-(benzoyloxymethyl)-5-cyanotetrahydrofuran-3,4-diyl dibenzoate |
| 2,5-ANHYDRO-3,4,6-TRI-O-BENZOYL-D-ALLONONITRILE |
| 2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide |
| 2,3-DIFLUORO-6-METHOXYPHENYLACETIC ACID |
| 2,5-Anhydro-3,4,6-tri-O-benzoyl-D-allononitrile |
| 2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl cyanide |