Tubulin polymerization-IN-19 structure
|
Common Name | Tubulin polymerization-IN-19 | ||
|---|---|---|---|---|
| CAS Number | 2340345-85-7 | Molecular Weight | 419.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tubulin polymerization-IN-19Tubulin polymerization-IN-19 (compound 4) is a potent inhibitor of tubulin polymerization. Tubulin polymerization-IN-20 has the potential for the research of breast cancers and chemoresistant colon cancers[1]. |
| Name | Tubulin polymerization-IN-19 |
|---|
| Description | Tubulin polymerization-IN-19 (compound 4) is a potent inhibitor of tubulin polymerization. Tubulin polymerization-IN-20 has the potential for the research of breast cancers and chemoresistant colon cancers[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H25NO5 |
|---|---|
| Molecular Weight | 419.47 |
| InChIKey | HWNABQNNNBLHBS-GOTSBHOMSA-N |
| SMILES | COc1ccc(C2C(c3ccccc3)C(=O)N2c2cc(OC)c(OC)c(OC)c2)cc1 |