Tubulin polymerization-IN-20 structure
|
Common Name | Tubulin polymerization-IN-20 | ||
|---|---|---|---|---|
| CAS Number | 2410619-45-1 | Molecular Weight | 437.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H24FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tubulin polymerization-IN-20Tubulin polymerization-IN-20 (compound 11) is a potent inhibitor of tubulin polymerization. Tubulin polymerization-IN-20 has the potential for the research of breast cancers and chemoresistant colon cancers[1]. |
| Name | Tubulin polymerization-IN-20 |
|---|
| Description | Tubulin polymerization-IN-20 (compound 11) is a potent inhibitor of tubulin polymerization. Tubulin polymerization-IN-20 has the potential for the research of breast cancers and chemoresistant colon cancers[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H24FNO5 |
|---|---|
| Molecular Weight | 437.46 |
| InChIKey | SXXFGTCCPRGGCJ-DHIUTWEWSA-N |
| SMILES | COc1ccc(C2C(c3ccccc3)C(=O)N2c2cc(OC)c(OC)c(OC)c2)cc1F |