Stigmasta-5,25-dien-3-ol,(3b,24S)- structure
|
Common Name | Stigmasta-5,25-dien-3-ol,(3b,24S)- | ||
|---|---|---|---|---|
| CAS Number | 2364-23-0 | Molecular Weight | 412.69 | |
| Density | 0.98g/cm3 | Boiling Point | 502.7ºC at 760mmHg | |
| Molecular Formula | C29H48O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.8ºC | |
Use of Stigmasta-5,25-dien-3-ol,(3b,24S)-(-)-Clerosterol is a natural product that can be isolated from Codium fragile[1]. |
| Name | Clerosterol |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Clerosterol is a natural product that can be isolated from Codium fragile[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 502.7ºC at 760mmHg |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.69 |
| Flash Point | 219.8ºC |
| Exact Mass | 412.37100 |
| PSA | 20.23000 |
| LogP | 7.94490 |
| Vapour Pressure | 3.26E-12mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | GHGKPLPBPGYSOO-FBZNIEFRSA-N |
| SMILES | C=C(C)C(CC)CCC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 24-epiclerosterol |