4-(trifluoromethyl)diphenyl ether structure
|
Common Name | 4-(trifluoromethyl)diphenyl ether | ||
|---|---|---|---|---|
| CAS Number | 2367-02-4 | Molecular Weight | 238.20500 | |
| Density | 1.23g/cm3 | Boiling Point | 180°C 10mm | |
| Molecular Formula | C13H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180°C/10mm | |
| Name | 1-phenoxy-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 180°C 10mm |
| Molecular Formula | C13H9F3O |
| Molecular Weight | 238.20500 |
| Flash Point | 180°C/10mm |
| Exact Mass | 238.06100 |
| PSA | 9.23000 |
| LogP | 4.49770 |
| Vapour Pressure | 0.0167mmHg at 25°C |
| Index of Refraction | 1.5135 |
| InChIKey | UZJUDUZMPNCXPF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(Oc2ccccc2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-trifluoromethyldiphenyl ether |
| phenyl 4-trifluoromethylphenyl ether |
| 1-phenoxy-4-trifluoromethylbenzene |
| 4-phenoxybenzylidyne trifluoride |
| MFCD01631641 |
| 4-phenoxytrifluoromethylbenzene |