PROTAC IRAK4 degrader-3 structure
|
Common Name | PROTAC IRAK4 degrader-3 | ||
|---|---|---|---|---|
| CAS Number | 2374122-43-5 | Molecular Weight | 1086.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C57H68FN11O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PROTAC IRAK4 degrader-3PROTAC IRAK4 degrader-3 is a PROTAC-induced IRAK4 degrader[1]. |
| Name | PROTAC IRAK4 degrader-3 |
|---|
| Description | PROTAC IRAK4 degrader-3 is a PROTAC-induced IRAK4 degrader[1]. |
|---|---|
| Related Catalog | |
| Target |
IRAK4 |
| In Vitro | PROTAC IRAK4 degrader-3 (0.01~10 μM; 2 hours; PBMCs) mediated degradation is occurring in a proteasome dependent manner[1]. PROTAC IRAK4 degrader-3 (0.01~100 μM; 18 hours; PBMCs) is capable of completely blocking IL-6 secretion[1]. Western Blot Analysis[1] Cell Line: PBMCs Concentration: 0.01~10 μM Incubation Time: 2 hours Result: IRAK4 PROTAC-mediated degradation was occurring in a proteasome dependent manner. |
| References |
| Molecular Formula | C57H68FN11O8S |
|---|---|
| Molecular Weight | 1086.28 |
| InChIKey | VCCDOPPWOSIMCD-HCDYCOHBSA-N |
| SMILES | CCC1C(COc2ncc(C#CCN3CCC4(CC3)CCN(c3ncc(C(=O)NC(C(=O)N5CC(O)CC5C(=O)NCc5ccc(-c6scnc6C)cc5)C(C)(C)C)cn3)CC4)c3cc(C(N)=O)c(OC)cc23)NC(=O)C1F |
| Storage condition | 2-8°C |